C17H26O7 — CID 154793140
[(1R,2S,6S,7S,8R,9R)-8-hydroxy-4,4,11,11-tetramethyl-3,5,10,12-tetraoxatricyclo[7.3.0.02,6]dodecan-7-yl] 3-methylbut-2-enoate (PubChem CID 154793140) has the molecular formula C17H26O7 and a molecular weight of 342.39 g/mol. Its IUPAC name is [(1R,2S,6S,7S,8R,9R)-8-hydroxy-4,4,11,11-tetramethyl-3,5,10,12-tetraoxatricyclo[7.3.0.02,6]dodecan-7-yl] 3-methylbut-2-enoate.
| Compound Name | [(1R,2S,6S,7S,8R,9R)-8-hydroxy-4,4,11,11-tetramethyl-3,5,10,12-tetraoxatricyclo[7.3.0.02,6]dodecan-7-yl] 3-methylbut-2-enoate |
|---|---|
| PubChem CID | 154793140 |
| Molecular Formula | C17H26O7 |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | [(1R,2S,6S,7S,8R,9R)-8-hydroxy-4,4,11,11-tetramethyl-3,5,10,12-tetraoxatricyclo[7.3.0.02,6]dodecan-7-yl] 3-methylbut-2-enoate |
| SMILES | CC(C)=CC(=O)O[C@H]1[C@H](O)[C@H]2OC(C)(C)O[C@H]2[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C17H26O7/c1-8(2)7-9(18)20-11-10(19)12-14(23-16(3,4)21-12)15-13(11)22-17(5,6)24-15/h7,10-15,19H,1-6H3/t10-,11-,12+,13+,14+,15+/m0/s1 |
| InChIKey | SCLAEIZOZLBCMW-BBZRCZKMSA-N |
| XLogP | 1.28 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|