C20H30O10 — CID 163048790
[2,3-diacetyloxy-4,5-dihydroxy-6-(3-methylbutanoyloxy)cyclohexyl] 2-methylbut-2-enoate (PubChem CID 163048790) has the molecular formula C20H30O10 and a molecular weight of 430.45 g/mol. Its IUPAC name is [2,3-diacetyloxy-4,5-dihydroxy-6-(3-methylbutanoyloxy)cyclohexyl] 2-methylbut-2-enoate.
| Compound Name | [2,3-diacetyloxy-4,5-dihydroxy-6-(3-methylbutanoyloxy)cyclohexyl] 2-methylbut-2-enoate |
|---|---|
| PubChem CID | 163048790 |
| Molecular Formula | C20H30O10 |
| Molecular Weight | 430.45 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | [2,3-diacetyloxy-4,5-dihydroxy-6-(3-methylbutanoyloxy)cyclohexyl] 2-methylbut-2-enoate |
| SMILES | CC=C(C)C(=O)OC1C(OC(=O)CC(C)C)C(O)C(O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C20H30O10/c1-7-10(4)20(26)30-19-17(29-13(23)8-9(2)3)15(25)14(24)16(27-11(5)21)18(19)28-12(6)22/h7,9,14-19,24-25H,8H2,1-6H3 |
| InChIKey | XSJNECBNDGFAMJ-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.45 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|