C23H32O10 — CID 162982236
[4-acetyloxy-2,3-dihydroxy-5,6-bis(2-methylbut-2-enoyloxy)cyclohexyl] 2-methylbut-2-enoate (PubChem CID 162982236) has the molecular formula C23H32O10 and a molecular weight of 468.50 g/mol. Its IUPAC name is [4-acetyloxy-2,3-dihydroxy-5,6-bis(2-methylbut-2-enoyloxy)cyclohexyl] 2-methylbut-2-enoate.
| Compound Name | [4-acetyloxy-2,3-dihydroxy-5,6-bis(2-methylbut-2-enoyloxy)cyclohexyl] 2-methylbut-2-enoate |
|---|---|
| PubChem CID | 162982236 |
| Molecular Formula | C23H32O10 |
| Molecular Weight | 468.50 g/mol |
| Exact Mass | 468.20 |
| IUPAC Name | [4-acetyloxy-2,3-dihydroxy-5,6-bis(2-methylbut-2-enoyloxy)cyclohexyl] 2-methylbut-2-enoate |
| SMILES | CC=C(C)C(=O)OC1C(O)C(O)C(OC(C)=O)C(OC(=O)C(C)=CC)C1OC(=O)C(C)=CC |
| InChI | InChI=1S/C23H32O10/c1-8-11(4)21(27)31-18-16(26)15(25)17(30-14(7)24)19(32-22(28)12(5)9-2)20(18)33-23(29)13(6)10-3/h8-10,15-20,25-26H,1-7H3 |
| InChIKey | XEPLPNDOHGTVRI-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.50 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|