C22H32O9 — CID 162818864
[(1S,2R,3R,4S,5R,6S)-2,3,6-trihydroxy-4,5-bis(2-methylbut-2-enoyloxy)cyclohexyl] (E)-3-methylpent-2-enoate (PubChem CID 162818864) has the molecular formula C22H32O9 and a molecular weight of 440.49 g/mol. Its IUPAC name is [(1S,2R,3R,4S,5R,6S)-2,3,6-trihydroxy-4,5-bis(2-methylbut-2-enoyloxy)cyclohexyl] (E)-3-methylpent-2-enoate.
| Compound Name | [(1S,2R,3R,4S,5R,6S)-2,3,6-trihydroxy-4,5-bis(2-methylbut-2-enoyloxy)cyclohexyl] (E)-3-methylpent-2-enoate |
|---|---|
| PubChem CID | 162818864 |
| Molecular Formula | C22H32O9 |
| Molecular Weight | 440.49 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | [(1S,2R,3R,4S,5R,6S)-2,3,6-trihydroxy-4,5-bis(2-methylbut-2-enoyloxy)cyclohexyl] (E)-3-methylpent-2-enoate |
| SMILES | CC=C(C)C(=O)O[C@@H]1[C@@H](O)[C@@H](OC(=O)/C=C(\C)CC)[C@H](O)C(O)[C@@H]1OC(=O)C(C)=CC |
| InChI | InChI=1S/C22H32O9/c1-7-11(4)10-14(23)29-18-15(24)16(25)19(30-21(27)12(5)8-2)20(17(18)26)31-22(28)13(6)9-3/h8-10,15-20,24-26H,7H2,1-6H3/b11-10+,12-8?,13-9?/t15-,16?,17+,18+,19+,20-/m1/s1 |
| InChIKey | BVHSIMOPFXDATD-JJQXJABSSA-N |
| XLogP | 1.11 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.49 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|