C25H36O6 — CID 162824406
(1S,4E,7S,8Z,10R,11R)-7-[(E)-4-hydroxy-4-methylpent-2-enyl]-7,11-dimethyl-10-(3-methylbut-2-enoyloxy)-12-oxabicyclo[9.1.0]dodeca-4,8-diene-4-carboxylic acid (PubChem CID 162824406) has the molecular formula C25H36O6 and a molecular weight of 432.56 g/mol. Its IUPAC name is (1S,4E,7S,8Z,10R,11R)-7-[(E)-4-hydroxy-4-methylpent-2-enyl]-7,11-dimethyl-10-(3-methylbut-2-enoyloxy)-12-oxabicyclo[9.1.0]dodeca-4,8-diene-4-carboxylic acid.
| Compound Name | (1S,4E,7S,8Z,10R,11R)-7-[(E)-4-hydroxy-4-methylpent-2-enyl]-7,11-dimethyl-10-(3-methylbut-2-enoyloxy)-12-oxabicyclo[9.1.0]dodeca-4,8-diene-4-carboxylic acid |
|---|---|
| PubChem CID | 162824406 |
| Molecular Formula | C25H36O6 |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | (1S,4E,7S,8Z,10R,11R)-7-[(E)-4-hydroxy-4-methylpent-2-enyl]-7,11-dimethyl-10-(3-methylbut-2-enoyloxy)-12-oxabicyclo[9.1.0]dodeca-4,8-diene-4-carboxylic acid |
| SMILES | CC(C)=CC(=O)O[C@@H]1/C=C\[C@@](C)(C/C=C/C(C)(C)O)C/C=C(/C(=O)O)CC[C@@H]2O[C@]21C |
| InChI | InChI=1S/C25H36O6/c1-17(2)16-21(26)30-19-11-15-24(5,13-7-12-23(3,4)29)14-10-18(22(27)28)8-9-20-25(19,6)31-20/h7,10-12,15-16,19-20,29H,8-9,13-14H2,1-6H3,(H,27,28)/b12-7+,15-11-,18-10+/t19-,20+,24+,25+/m1/s1 |
| InChIKey | XDIQXYAYOHAXSB-VANIRRPLSA-N |
| XLogP | 4.50 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|