C25H36O6 — CID 138990075
[(4E,8Z)-2-hydroxy-9-(hydroxymethyl)-2,6-dimethyl-6-(4-methylpent-3-enyl)-10-oxo-12-oxabicyclo[9.1.0]dodeca-4,8-dien-3-yl] 3-methylbut-2-enoate (PubChem CID 138990075) has the molecular formula C25H36O6 and a molecular weight of 432.56 g/mol. Its IUPAC name is [(4E,8Z)-2-hydroxy-9-(hydroxymethyl)-2,6-dimethyl-6-(4-methylpent-3-enyl)-10-oxo-12-oxabicyclo[9.1.0]dodeca-4,8-dien-3-yl] 3-methylbut-2-enoate.
| Compound Name | [(4E,8Z)-2-hydroxy-9-(hydroxymethyl)-2,6-dimethyl-6-(4-methylpent-3-enyl)-10-oxo-12-oxabicyclo[9.1.0]dodeca-4,8-dien-3-yl] 3-methylbut-2-enoate |
|---|---|
| PubChem CID | 138990075 |
| Molecular Formula | C25H36O6 |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | [(4E,8Z)-2-hydroxy-9-(hydroxymethyl)-2,6-dimethyl-6-(4-methylpent-3-enyl)-10-oxo-12-oxabicyclo[9.1.0]dodeca-4,8-dien-3-yl] 3-methylbut-2-enoate |
| SMILES | CC(C)=CCCC1(C)/C=C/C(OC(=O)C=C(C)C)C(C)(O)C2OC2C(=O)/C(CO)=C\C1 |
| InChI | InChI=1S/C25H36O6/c1-16(2)8-7-11-24(5)12-9-18(15-26)21(28)22-23(31-22)25(6,29)19(10-13-24)30-20(27)14-17(3)4/h8-10,13-14,19,22-23,26,29H,7,11-12,15H2,1-6H3/b13-10+,18-9- |
| InChIKey | MRONODIEWDCJKX-UGXMITNPSA-N |
| XLogP | 3.58 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|