C26H40O5 — CID 91541599
[(1R,4S,11S)-7-(hydroxymethyl)-10-methoxy-4,11-dimethyl-4-(4-methylpent-3-enyl)-8-oxocycloundeca-2,5-dien-1-yl] 3-methylbut-2-enoate (PubChem CID 91541599) has the molecular formula C26H40O5 and a molecular weight of 432.60 g/mol. Its IUPAC name is [(1R,4S,11S)-7-(hydroxymethyl)-10-methoxy-4,11-dimethyl-4-(4-methylpent-3-enyl)-8-oxocycloundeca-2,5-dien-1-yl] 3-methylbut-2-enoate.
| Compound Name | [(1R,4S,11S)-7-(hydroxymethyl)-10-methoxy-4,11-dimethyl-4-(4-methylpent-3-enyl)-8-oxocycloundeca-2,5-dien-1-yl] 3-methylbut-2-enoate |
|---|---|
| PubChem CID | 91541599 |
| Molecular Formula | C26H40O5 |
| Molecular Weight | 432.60 g/mol |
| Exact Mass | 432.29 |
| IUPAC Name | [(1R,4S,11S)-7-(hydroxymethyl)-10-methoxy-4,11-dimethyl-4-(4-methylpent-3-enyl)-8-oxocycloundeca-2,5-dien-1-yl] 3-methylbut-2-enoate |
| SMILES | COC1CC(=O)C(CO)C=C[C@](C)(CCC=C(C)C)C=C[C@@H](OC(=O)C=C(C)C)[C@H]1C |
| InChI | InChI=1S/C26H40O5/c1-18(2)9-8-12-26(6)13-10-21(17-27)22(28)16-24(30-7)20(5)23(11-14-26)31-25(29)15-19(3)4/h9-11,13-15,20-21,23-24,27H,8,12,16-17H2,1-7H3/t20-,21?,23-,24?,26+/m1/s1 |
| InChIKey | MHCRUCJNNQPYKR-OHLUCTKGSA-N |
| XLogP | 4.96 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.60 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|