C28H48O2 — CID 161259407
(2R,3R,6R)-2,3,6-trimethyl-6-(4-methylpent-3-enyl)-2,3-dihydropyran;(2R,3R,6S)-2,3,6-trimethyl-6-(4-methylpent-3-enyl)-2,3-dihydropyran (PubChem CID 161259407) has the molecular formula C28H48O2 and a molecular weight of 416.69 g/mol. Its IUPAC name is (2R,3R,6R)-2,3,6-trimethyl-6-(4-methylpent-3-enyl)-2,3-dihydropyran;(2R,3R,6S)-2,3,6-trimethyl-6-(4-methylpent-3-enyl)-2,3-dihydropyran.
| Compound Name | (2R,3R,6R)-2,3,6-trimethyl-6-(4-methylpent-3-enyl)-2,3-dihydropyran;(2R,3R,6S)-2,3,6-trimethyl-6-(4-methylpent-3-enyl)-2,3-dihydropyran |
|---|---|
| PubChem CID | 161259407 |
| Molecular Formula | C28H48O2 |
| Molecular Weight | 416.69 g/mol |
| Exact Mass | 416.37 |
| IUPAC Name | (2R,3R,6R)-2,3,6-trimethyl-6-(4-methylpent-3-enyl)-2,3-dihydropyran;(2R,3R,6S)-2,3,6-trimethyl-6-(4-methylpent-3-enyl)-2,3-dihydropyran |
| SMILES | CC(C)=CCC[C@@]1(C)C=C[C@@H](C)[C@@H](C)O1.CC(C)=CCC[C@]1(C)C=C[C@@H](C)[C@@H](C)O1 |
| InChI | InChI=1S/2C14H24O/c2*1-11(2)7-6-9-14(5)10-8-12(3)13(4)15-14/h2*7-8,10,12-13H,6,9H2,1-5H3/t12-,13-,14+;12-,13-,14-/m11/s1 |
| InChIKey | VCIWUXXSYFTVCW-GDRLAVGMSA-N |
| XLogP | 8.20 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.69 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|