C15H24O3 — CID 175045169
[2-(3-methylbut-2-enoxy)cyclopentyl] 3-methylbut-2-enoate (PubChem CID 175045169) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is [2-(3-methylbut-2-enoxy)cyclopentyl] 3-methylbut-2-enoate.
| Compound Name | [2-(3-methylbut-2-enoxy)cyclopentyl] 3-methylbut-2-enoate |
|---|---|
| PubChem CID | 175045169 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | [2-(3-methylbut-2-enoxy)cyclopentyl] 3-methylbut-2-enoate |
| SMILES | CC(C)=CCOC1CCCC1OC(=O)C=C(C)C |
| InChI | InChI=1S/C15H24O3/c1-11(2)8-9-17-13-6-5-7-14(13)18-15(16)10-12(3)4/h8,10,13-14H,5-7,9H2,1-4H3 |
| InChIKey | AMVBSMGRJMVQCX-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|