C22H36O8 — CID 161310879
acetyl acetate;[(1R,2R)-2-prop-2-enoxycyclopentyl] acetate;trans-(1R,2R)-2-prop-2-enoxycyclopentan-1-ol (PubChem CID 161310879) has the molecular formula C22H36O8 and a molecular weight of 428.52 g/mol. Its IUPAC name is acetyl acetate;[(1R,2R)-2-prop-2-enoxycyclopentyl] acetate;trans-(1R,2R)-2-prop-2-enoxycyclopentan-1-ol.
| Compound Name | acetyl acetate;[(1R,2R)-2-prop-2-enoxycyclopentyl] acetate;trans-(1R,2R)-2-prop-2-enoxycyclopentan-1-ol |
|---|---|
| PubChem CID | 161310879 |
| Molecular Formula | C22H36O8 |
| Molecular Weight | 428.52 g/mol |
| Exact Mass | 428.24 |
| IUPAC Name | acetyl acetate;[(1R,2R)-2-prop-2-enoxycyclopentyl] acetate;trans-(1R,2R)-2-prop-2-enoxycyclopentan-1-ol |
| SMILES | C=CCO[C@@H]1CCC[C@H]1O.C=CCO[C@@H]1CCC[C@H]1OC(C)=O.CC(=O)OC(C)=O |
| InChI | InChI=1S/C10H16O3.C8H14O2.C4H6O3/c1-3-7-12-9-5-4-6-10(9)13-8(2)11;1-2-6-10-8-5-3-4-7(8)9;1-3(5)7-4(2)6/h3,9-10H,1,4-7H2,2H3;2,7-9H,1,3-6H2;1-2H3/t9-,10-;7-,8-;/m11./s1 |
| InChIKey | VIWITEGRFMAXIM-IQFYAPODSA-N |
| XLogP | 2.87 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.52 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|