C15H24O5 — CID 125416483
(2R,3R,3aS,8aR)-2,3-dihydroxy-3-(2-hydroxypropan-2-yl)-8a-methyl-1,2,3a,4,5,8-hexahydroazulene-6-carboxylic acid (PubChem CID 125416483) has the molecular formula C15H24O5 and a molecular weight of 284.35 g/mol. Its IUPAC name is (2R,3R,3aS,8aR)-2,3-dihydroxy-3-(2-hydroxypropan-2-yl)-8a-methyl-1,2,3a,4,5,8-hexahydroazulene-6-carboxylic acid.
| Compound Name | (2R,3R,3aS,8aR)-2,3-dihydroxy-3-(2-hydroxypropan-2-yl)-8a-methyl-1,2,3a,4,5,8-hexahydroazulene-6-carboxylic acid |
|---|---|
| PubChem CID | 125416483 |
| Molecular Formula | C15H24O5 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | (2R,3R,3aS,8aR)-2,3-dihydroxy-3-(2-hydroxypropan-2-yl)-8a-methyl-1,2,3a,4,5,8-hexahydroazulene-6-carboxylic acid |
| SMILES | CC(C)(O)[C@]1(O)[C@H](O)C[C@@]2(C)CC=C(C(=O)O)CC[C@@H]21 |
| InChI | InChI=1S/C15H24O5/c1-13(2,19)15(20)10-5-4-9(12(17)18)6-7-14(10,3)8-11(15)16/h6,10-11,16,19-20H,4-5,7-8H2,1-3H3,(H,17,18)/t10-,11+,14+,15+/m0/s1 |
| InChIKey | QUIVGWOGXNIYFU-RBDSIQFVSA-N |
| XLogP | 1.07 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |