C17H28O4 — CID 170989789
[(2R,3S,3aS,8aR)-2,3-dihydroxy-8a-methyl-3-propan-2-yl-1,2,3a,4,5,8-hexahydroazulen-6-yl]methyl acetate (PubChem CID 170989789) has the molecular formula C17H28O4 and a molecular weight of 296.41 g/mol. Its IUPAC name is [(2R,3S,3aS,8aR)-2,3-dihydroxy-8a-methyl-3-propan-2-yl-1,2,3a,4,5,8-hexahydroazulen-6-yl]methyl acetate.
| Compound Name | [(2R,3S,3aS,8aR)-2,3-dihydroxy-8a-methyl-3-propan-2-yl-1,2,3a,4,5,8-hexahydroazulen-6-yl]methyl acetate |
|---|---|
| PubChem CID | 170989789 |
| Molecular Formula | C17H28O4 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | [(2R,3S,3aS,8aR)-2,3-dihydroxy-8a-methyl-3-propan-2-yl-1,2,3a,4,5,8-hexahydroazulen-6-yl]methyl acetate |
| SMILES | CC(=O)OCC1=CC[C@]2(C)C[C@@H](O)[C@](O)(C(C)C)[C@H]2CC1 |
| InChI | InChI=1S/C17H28O4/c1-11(2)17(20)14-6-5-13(10-21-12(3)18)7-8-16(14,4)9-15(17)19/h7,11,14-15,19-20H,5-6,8-10H2,1-4H3/t14-,15+,16+,17-/m0/s1 |
| InChIKey | SGHAXQPYIMBJST-HZMVEIRTSA-N |
| XLogP | 2.43 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|