C17H22O3 — CID 155931362
[(7aS,7bS)-6,6,7b-trimethyl-4-oxo-1,2,7,7a-tetrahydrocyclobuta[e]inden-3-yl]methyl acetate (PubChem CID 155931362) has the molecular formula C17H22O3 and a molecular weight of 274.36 g/mol. Its IUPAC name is [(7aS,7bS)-6,6,7b-trimethyl-4-oxo-1,2,7,7a-tetrahydrocyclobuta[e]inden-3-yl]methyl acetate.
| Compound Name | [(7aS,7bS)-6,6,7b-trimethyl-4-oxo-1,2,7,7a-tetrahydrocyclobuta[e]inden-3-yl]methyl acetate |
|---|---|
| PubChem CID | 155931362 |
| Molecular Formula | C17H22O3 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | [(7aS,7bS)-6,6,7b-trimethyl-4-oxo-1,2,7,7a-tetrahydrocyclobuta[e]inden-3-yl]methyl acetate |
| SMILES | CC(=O)OCC1=C2CC[C@@]2(C)[C@@H]2CC(C)(C)C=C2C1=O |
| InChI | InChI=1S/C17H22O3/c1-10(18)20-9-12-13-5-6-17(13,4)14-8-16(2,3)7-11(14)15(12)19/h7,14H,5-6,8-9H2,1-4H3/t14-,17-/m1/s1 |
| InChIKey | ILHXYWVKYGAMQJ-RHSMWYFYSA-N |
| XLogP | 3.20 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |