C21H26O10 — CID 163044263
[(1S,8S,10R,11R)-8,10-diacetyloxy-11-hydroxy-1,10-dimethyl-5-oxo-4,14-dioxatricyclo[9.2.1.03,7]tetradeca-2,6-dien-6-yl]methyl acetate (PubChem CID 163044263) has the molecular formula C21H26O10 and a molecular weight of 438.43 g/mol. Its IUPAC name is [(1S,8S,10R,11R)-8,10-diacetyloxy-11-hydroxy-1,10-dimethyl-5-oxo-4,14-dioxatricyclo[9.2.1.03,7]tetradeca-2,6-dien-6-yl]methyl acetate.
| Compound Name | [(1S,8S,10R,11R)-8,10-diacetyloxy-11-hydroxy-1,10-dimethyl-5-oxo-4,14-dioxatricyclo[9.2.1.03,7]tetradeca-2,6-dien-6-yl]methyl acetate |
|---|---|
| PubChem CID | 163044263 |
| Molecular Formula | C21H26O10 |
| Molecular Weight | 438.43 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | [(1S,8S,10R,11R)-8,10-diacetyloxy-11-hydroxy-1,10-dimethyl-5-oxo-4,14-dioxatricyclo[9.2.1.03,7]tetradeca-2,6-dien-6-yl]methyl acetate |
| SMILES | CC(=O)OCC1=C2C(=C[C@]3(C)CC[C@@](O)(O3)[C@](C)(OC(C)=O)C[C@@H]2OC(C)=O)OC1=O |
| InChI | InChI=1S/C21H26O10/c1-11(22)27-10-14-17-15(29-18(14)25)8-19(4)6-7-21(26,31-19)20(5,30-13(3)24)9-16(17)28-12(2)23/h8,16,26H,6-7,9-10H2,1-5H3/t16-,19-,20+,21+/m0/s1 |
| InChIKey | SLFXSRCDJNCMKH-VRXWPRPYSA-N |
| XLogP | 1.20 |
| TPSA | 134.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.43 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|