C19H26O8 — CID 163000039
[(1S,2E,8S,10R,11R)-10-hydroxy-11-methoxy-6-(methoxymethyl)-1,10-dimethyl-5-oxo-4,14-dioxatricyclo[9.2.1.03,7]tetradeca-2,6-dien-8-yl] acetate (PubChem CID 163000039) has the molecular formula C19H26O8 and a molecular weight of 382.41 g/mol. Its IUPAC name is [(1S,2E,8S,10R,11R)-10-hydroxy-11-methoxy-6-(methoxymethyl)-1,10-dimethyl-5-oxo-4,14-dioxatricyclo[9.2.1.03,7]tetradeca-2,6-dien-8-yl] acetate.
| Compound Name | [(1S,2E,8S,10R,11R)-10-hydroxy-11-methoxy-6-(methoxymethyl)-1,10-dimethyl-5-oxo-4,14-dioxatricyclo[9.2.1.03,7]tetradeca-2,6-dien-8-yl] acetate |
|---|---|
| PubChem CID | 163000039 |
| Molecular Formula | C19H26O8 |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | [(1S,2E,8S,10R,11R)-10-hydroxy-11-methoxy-6-(methoxymethyl)-1,10-dimethyl-5-oxo-4,14-dioxatricyclo[9.2.1.03,7]tetradeca-2,6-dien-8-yl] acetate |
| SMILES | COCC1=C2/C(=C\[C@]3(C)CC[C@@](OC)(O3)[C@](C)(O)C[C@@H]2OC(C)=O)OC1=O |
| InChI | InChI=1S/C19H26O8/c1-11(20)25-14-9-18(3,22)19(24-5)7-6-17(2,27-19)8-13-15(14)12(10-23-4)16(21)26-13/h8,14,22H,6-7,9-10H2,1-5H3/b13-8+/t14-,17-,18+,19+/m0/s1 |
| InChIKey | SFNLXNCRZKRCJC-DTDVGYQLSA-N |
| XLogP | 1.37 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |