C23H30O9 — CID 163020865
[(1S,2E,8R,10R,11R)-6-(acetyloxymethyl)-10-hydroxy-11-methoxy-1,10-dimethyl-5-oxo-4,14-dioxatricyclo[9.2.1.03,7]tetradeca-2,6-dien-8-yl] (E)-2-methylbut-2-enoate (PubChem CID 163020865) has the molecular formula C23H30O9 and a molecular weight of 450.48 g/mol. Its IUPAC name is [(1S,2E,8R,10R,11R)-6-(acetyloxymethyl)-10-hydroxy-11-methoxy-1,10-dimethyl-5-oxo-4,14-dioxatricyclo[9.2.1.03,7]tetradeca-2,6-dien-8-yl] (E)-2-methylbut-2-enoate.
| Compound Name | [(1S,2E,8R,10R,11R)-6-(acetyloxymethyl)-10-hydroxy-11-methoxy-1,10-dimethyl-5-oxo-4,14-dioxatricyclo[9.2.1.03,7]tetradeca-2,6-dien-8-yl] (E)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 163020865 |
| Molecular Formula | C23H30O9 |
| Molecular Weight | 450.48 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | [(1S,2E,8R,10R,11R)-6-(acetyloxymethyl)-10-hydroxy-11-methoxy-1,10-dimethyl-5-oxo-4,14-dioxatricyclo[9.2.1.03,7]tetradeca-2,6-dien-8-yl] (E)-2-methylbut-2-enoate |
| SMILES | C/C=C(\C)C(=O)O[C@@H]1C[C@@](C)(O)[C@@]2(OC)CC[C@@](C)(/C=C3/OC(=O)C(COC(C)=O)=C31)O2 |
| InChI | InChI=1S/C23H30O9/c1-7-13(2)19(25)30-17-11-22(5,27)23(28-6)9-8-21(4,32-23)10-16-18(17)15(20(26)31-16)12-29-14(3)24/h7,10,17,27H,8-9,11-12H2,1-6H3/b13-7+,16-10+/t17-,21+,22-,23-/m1/s1 |
| InChIKey | KMYNFLQGDUKKKB-FPODCBCJSA-N |
| XLogP | 2.23 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.48 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|