C21H26O9 — CID 162903676
[(1S,2E,8S,10R,11R)-6-(acetyloxymethyl)-11-hydroxy-1,10-dimethyl-5-oxo-4,14-dioxatricyclo[9.2.1.03,7]tetradeca-2,6-dien-8-yl] 2-(hydroxymethyl)prop-2-enoate (PubChem CID 162903676) has the molecular formula C21H26O9 and a molecular weight of 422.43 g/mol. Its IUPAC name is [(1S,2E,8S,10R,11R)-6-(acetyloxymethyl)-11-hydroxy-1,10-dimethyl-5-oxo-4,14-dioxatricyclo[9.2.1.03,7]tetradeca-2,6-dien-8-yl] 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | [(1S,2E,8S,10R,11R)-6-(acetyloxymethyl)-11-hydroxy-1,10-dimethyl-5-oxo-4,14-dioxatricyclo[9.2.1.03,7]tetradeca-2,6-dien-8-yl] 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 162903676 |
| Molecular Formula | C21H26O9 |
| Molecular Weight | 422.43 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | [(1S,2E,8S,10R,11R)-6-(acetyloxymethyl)-11-hydroxy-1,10-dimethyl-5-oxo-4,14-dioxatricyclo[9.2.1.03,7]tetradeca-2,6-dien-8-yl] 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=C(CO)C(=O)O[C@H]1C[C@@H](C)[C@@]2(O)CC[C@@](C)(/C=C3/OC(=O)C(COC(C)=O)=C31)O2 |
| InChI | InChI=1S/C21H26O9/c1-11(9-22)18(24)28-15-7-12(2)21(26)6-5-20(4,30-21)8-16-17(15)14(19(25)29-16)10-27-13(3)23/h8,12,15,22,26H,1,5-7,9-10H2,2-4H3/b16-8+/t12-,15+,20+,21-/m1/s1 |
| InChIKey | NGTWBDRDYZFHJM-SAGDIXFDSA-N |
| XLogP | 1.04 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.43 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|