C21H22O9 — CID 162924080
[(1S,8S,10S)-6-(acetyloxymethyl)-1,10-dimethyl-5,13-dioxo-4,14-dioxatricyclo[9.2.1.03,7]tetradeca-2,6,11-trien-8-yl] 2-(hydroxymethyl)prop-2-enoate (PubChem CID 162924080) has the molecular formula C21H22O9 and a molecular weight of 418.40 g/mol. Its IUPAC name is [(1S,8S,10S)-6-(acetyloxymethyl)-1,10-dimethyl-5,13-dioxo-4,14-dioxatricyclo[9.2.1.03,7]tetradeca-2,6,11-trien-8-yl] 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | [(1S,8S,10S)-6-(acetyloxymethyl)-1,10-dimethyl-5,13-dioxo-4,14-dioxatricyclo[9.2.1.03,7]tetradeca-2,6,11-trien-8-yl] 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 162924080 |
| Molecular Formula | C21H22O9 |
| Molecular Weight | 418.40 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | [(1S,8S,10S)-6-(acetyloxymethyl)-1,10-dimethyl-5,13-dioxo-4,14-dioxatricyclo[9.2.1.03,7]tetradeca-2,6,11-trien-8-yl] 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=C(CO)C(=O)O[C@H]1C[C@H](C)C2=CC(=O)[C@](C)(C=C3OC(=O)C(COC(C)=O)=C31)O2 |
| InChI | InChI=1S/C21H22O9/c1-10-5-15(28-19(25)11(2)8-22)18-13(9-27-12(3)23)20(26)29-16(18)7-21(4)17(24)6-14(10)30-21/h6-7,10,15,22H,2,5,8-9H2,1,3-4H3/t10-,15-,21-/m0/s1 |
| InChIKey | AALHLBOYBDTNEN-QYAMTVPHSA-N |
| XLogP | 1.03 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.40 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|