C25H28O11 — CID 162897789
[8-acetyl-15-(acetyloxymethyl)-4,11-dimethyl-9,16-dioxo-3,10,17-trioxatetracyclo[12.3.0.02,4.07,11]heptadeca-7,14-dien-13-yl] 2-(hydroxymethyl)prop-2-enoate (PubChem CID 162897789) has the molecular formula C25H28O11 and a molecular weight of 504.49 g/mol. Its IUPAC name is [8-acetyl-15-(acetyloxymethyl)-4,11-dimethyl-9,16-dioxo-3,10,17-trioxatetracyclo[12.3.0.02,4.07,11]heptadeca-7,14-dien-13-yl] 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | [8-acetyl-15-(acetyloxymethyl)-4,11-dimethyl-9,16-dioxo-3,10,17-trioxatetracyclo[12.3.0.02,4.07,11]heptadeca-7,14-dien-13-yl] 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 162897789 |
| Molecular Formula | C25H28O11 |
| Molecular Weight | 504.49 g/mol |
| Exact Mass | 504.16 |
| IUPAC Name | [8-acetyl-15-(acetyloxymethyl)-4,11-dimethyl-9,16-dioxo-3,10,17-trioxatetracyclo[12.3.0.02,4.07,11]heptadeca-7,14-dien-13-yl] 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=C(CO)C(=O)OC1CC2(C)OC(=O)C(C(C)=O)=C2CCC2(C)OC2C2OC(=O)C(COC(C)=O)=C12 |
| InChI | InChI=1S/C25H28O11/c1-11(9-26)21(29)33-16-8-25(5)15(17(12(2)27)23(31)36-25)6-7-24(4)20(35-24)19-18(16)14(22(30)34-19)10-32-13(3)28/h16,19-20,26H,1,6-10H2,2-5H3 |
| InChIKey | NKMOZRNDIOCVKC-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 155.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.49 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|