C21H24O9 — CID 177433316
[(1S,2R,4R,7S,9S)-13-(acetyloxymethyl)-9-(hydroxymethyl)-4-methyl-14-oxo-3,8,15-trioxatetracyclo[10.3.0.02,4.07,9]pentadeca-5,12-dien-11-yl] 2-methylprop-2-enoate (PubChem CID 177433316) has the molecular formula C21H24O9 and a molecular weight of 420.41 g/mol. Its IUPAC name is [(1S,2R,4R,7S,9S)-13-(acetyloxymethyl)-9-(hydroxymethyl)-4-methyl-14-oxo-3,8,15-trioxatetracyclo[10.3.0.02,4.07,9]pentadeca-5,12-dien-11-yl] 2-methylprop-2-enoate.
| Compound Name | [(1S,2R,4R,7S,9S)-13-(acetyloxymethyl)-9-(hydroxymethyl)-4-methyl-14-oxo-3,8,15-trioxatetracyclo[10.3.0.02,4.07,9]pentadeca-5,12-dien-11-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 177433316 |
| Molecular Formula | C21H24O9 |
| Molecular Weight | 420.41 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | [(1S,2R,4R,7S,9S)-13-(acetyloxymethyl)-9-(hydroxymethyl)-4-methyl-14-oxo-3,8,15-trioxatetracyclo[10.3.0.02,4.07,9]pentadeca-5,12-dien-11-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1C[C@@]2(CO)O[C@H]2C=C[C@@]2(C)O[C@@H]2[C@H]2OC(=O)C(COC(C)=O)=C12 |
| InChI | InChI=1S/C21H24O9/c1-10(2)18(24)27-13-7-21(9-22)14(29-21)5-6-20(4)17(30-20)16-15(13)12(19(25)28-16)8-26-11(3)23/h5-6,13-14,16-17,22H,1,7-9H2,2-4H3/t13?,14-,16-,17+,20+,21-/m0/s1 |
| InChIKey | GJDQYAUSYYHCGW-WOWPTCFPSA-N |
| XLogP | 0.51 |
| TPSA | 124.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.41 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|