C23H28O10 — CID 45359856
[(1S,2R,4R,5Z,7S,9S)-9,13-bis(acetyloxymethyl)-4-methyl-14-oxo-3,8,15-trioxatetracyclo[10.3.0.02,4.07,9]pentadeca-5,12-dien-11-yl] 2-methylpropanoate (PubChem CID 45359856) has the molecular formula C23H28O10 and a molecular weight of 464.47 g/mol. Its IUPAC name is [(1S,2R,4R,5Z,7S,9S)-9,13-bis(acetyloxymethyl)-4-methyl-14-oxo-3,8,15-trioxatetracyclo[10.3.0.02,4.07,9]pentadeca-5,12-dien-11-yl] 2-methylpropanoate.
| Compound Name | [(1S,2R,4R,5Z,7S,9S)-9,13-bis(acetyloxymethyl)-4-methyl-14-oxo-3,8,15-trioxatetracyclo[10.3.0.02,4.07,9]pentadeca-5,12-dien-11-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 45359856 |
| Molecular Formula | C23H28O10 |
| Molecular Weight | 464.47 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | [(1S,2R,4R,5Z,7S,9S)-9,13-bis(acetyloxymethyl)-4-methyl-14-oxo-3,8,15-trioxatetracyclo[10.3.0.02,4.07,9]pentadeca-5,12-dien-11-yl] 2-methylpropanoate |
| SMILES | CC(=O)OCC1=C2C(OC(=O)C(C)C)C[C@@]3(COC(C)=O)O[C@H]3/C=C\[C@@]3(C)O[C@@H]3[C@H]2OC1=O |
| InChI | InChI=1S/C23H28O10/c1-11(2)20(26)30-15-8-23(10-29-13(4)25)16(32-23)6-7-22(5)19(33-22)18-17(15)14(21(27)31-18)9-28-12(3)24/h6-7,11,15-16,18-19H,8-10H2,1-5H3/b7-6-/t15?,16-,18-,19+,22+,23-/m0/s1 |
| InChIKey | OKZUMIKPSHJYTI-NORGCPHFSA-N |
| XLogP | 1.16 |
| TPSA | 130.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.47 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|