C21H26O7 — CID 162952633
[6-(acetyloxymethyl)-10-formyl-3-methylidene-2-oxo-3a,4,7,8,11,11a-hexahydrocyclodeca[b]furan-7-yl] 2-methylpropanoate (PubChem CID 162952633) has the molecular formula C21H26O7 and a molecular weight of 390.43 g/mol. Its IUPAC name is [6-(acetyloxymethyl)-10-formyl-3-methylidene-2-oxo-3a,4,7,8,11,11a-hexahydrocyclodeca[b]furan-7-yl] 2-methylpropanoate.
| Compound Name | [6-(acetyloxymethyl)-10-formyl-3-methylidene-2-oxo-3a,4,7,8,11,11a-hexahydrocyclodeca[b]furan-7-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 162952633 |
| Molecular Formula | C21H26O7 |
| Molecular Weight | 390.43 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | [6-(acetyloxymethyl)-10-formyl-3-methylidene-2-oxo-3a,4,7,8,11,11a-hexahydrocyclodeca[b]furan-7-yl] 2-methylpropanoate |
| SMILES | C=C1C(=O)OC2CC(C=O)=CCC(OC(=O)C(C)C)C(COC(C)=O)=CCC12 |
| InChI | InChI=1S/C21H26O7/c1-12(2)20(24)27-18-8-5-15(10-22)9-19-17(13(3)21(25)28-19)7-6-16(18)11-26-14(4)23/h5-6,10,12,17-19H,3,7-9,11H2,1-2,4H3 |
| InChIKey | OWXFOZMXVQMPQK-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.43 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|