C20H26O5 — CID 73088941
(10-formyl-3-methylidene-2-oxo-3a,4,7,8,11,11a-hexahydrocyclodeca[b]furan-6-yl)methyl 3-methylbutanoate (PubChem CID 73088941) has the molecular formula C20H26O5 and a molecular weight of 346.42 g/mol. Its IUPAC name is (10-formyl-3-methylidene-2-oxo-3a,4,7,8,11,11a-hexahydrocyclodeca[b]furan-6-yl)methyl 3-methylbutanoate.
| Compound Name | (10-formyl-3-methylidene-2-oxo-3a,4,7,8,11,11a-hexahydrocyclodeca[b]furan-6-yl)methyl 3-methylbutanoate |
|---|---|
| PubChem CID | 73088941 |
| Molecular Formula | C20H26O5 |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | (10-formyl-3-methylidene-2-oxo-3a,4,7,8,11,11a-hexahydrocyclodeca[b]furan-6-yl)methyl 3-methylbutanoate |
| SMILES | C=C1C(=O)OC2CC(C=O)=CCCC(COC(=O)CC(C)C)=CCC12 |
| InChI | InChI=1S/C20H26O5/c1-13(2)9-19(22)24-12-15-5-4-6-16(11-21)10-18-17(8-7-15)14(3)20(23)25-18/h6-7,11,13,17-18H,3-5,8-10,12H2,1-2H3 |
| InChIKey | ZIISLDTWBFIFEJ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|