C21H28O6 — CID 101113851
[(3aS,7S,10E,11aR)-7-methoxy-3,6-dimethylidene-2,5-dioxo-3a,4,7,8,9,11a-hexahydrocyclodeca[b]furan-10-yl]methyl 3-methylbutanoate (PubChem CID 101113851) has the molecular formula C21H28O6 and a molecular weight of 376.45 g/mol. Its IUPAC name is [(3aS,7S,10E,11aR)-7-methoxy-3,6-dimethylidene-2,5-dioxo-3a,4,7,8,9,11a-hexahydrocyclodeca[b]furan-10-yl]methyl 3-methylbutanoate.
| Compound Name | [(3aS,7S,10E,11aR)-7-methoxy-3,6-dimethylidene-2,5-dioxo-3a,4,7,8,9,11a-hexahydrocyclodeca[b]furan-10-yl]methyl 3-methylbutanoate |
|---|---|
| PubChem CID | 101113851 |
| Molecular Formula | C21H28O6 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | [(3aS,7S,10E,11aR)-7-methoxy-3,6-dimethylidene-2,5-dioxo-3a,4,7,8,9,11a-hexahydrocyclodeca[b]furan-10-yl]methyl 3-methylbutanoate |
| SMILES | C=C1C(=O)C[C@H]2C(=C)C(=O)O[C@@H]2/C=C(/COC(=O)CC(C)C)CC[C@@H]1OC |
| InChI | InChI=1S/C21H28O6/c1-12(2)8-20(23)26-11-15-6-7-18(25-5)14(4)17(22)10-16-13(3)21(24)27-19(16)9-15/h9,12,16,18-19H,3-4,6-8,10-11H2,1-2,5H3/b15-9+/t16-,18-,19+/m0/s1 |
| InChIKey | YYNHEPWGKCPFEP-AVKZKWEKSA-N |
| XLogP | 2.92 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|