C22H28O6 — CID 14262484
[6-(acetyloxymethyl)-3,9-dimethylidene-2-oxo-4,5,7,8,9a,9b-hexahydro-3aH-azuleno[4,5-b]furan-8-yl] 3-methylbutanoate (PubChem CID 14262484) has the molecular formula C22H28O6 and a molecular weight of 388.46 g/mol. Its IUPAC name is [6-(acetyloxymethyl)-3,9-dimethylidene-2-oxo-4,5,7,8,9a,9b-hexahydro-3aH-azuleno[4,5-b]furan-8-yl] 3-methylbutanoate.
| Compound Name | [6-(acetyloxymethyl)-3,9-dimethylidene-2-oxo-4,5,7,8,9a,9b-hexahydro-3aH-azuleno[4,5-b]furan-8-yl] 3-methylbutanoate |
|---|---|
| PubChem CID | 14262484 |
| Molecular Formula | C22H28O6 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | [6-(acetyloxymethyl)-3,9-dimethylidene-2-oxo-4,5,7,8,9a,9b-hexahydro-3aH-azuleno[4,5-b]furan-8-yl] 3-methylbutanoate |
| SMILES | C=C1C(=O)OC2C1CCC(COC(C)=O)=C1CC(OC(=O)CC(C)C)C(=C)C12 |
| InChI | InChI=1S/C22H28O6/c1-11(2)8-19(24)27-18-9-17-15(10-26-14(5)23)6-7-16-12(3)22(25)28-21(16)20(17)13(18)4/h11,16,18,20-21H,3-4,6-10H2,1-2,5H3 |
| InChIKey | VMZPMJZNNBIDDN-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|