C19H22O7 — CID 163041654
[(1R,2S,6R,7E,11S)-8-(hydroxymethyl)-3-methylidene-4,13-dioxo-5,14-dioxatricyclo[10.2.1.02,6]pentadeca-7,12(15)-dien-11-yl] 2-methylpropanoate (PubChem CID 163041654) has the molecular formula C19H22O7 and a molecular weight of 362.38 g/mol. Its IUPAC name is [(1R,2S,6R,7E,11S)-8-(hydroxymethyl)-3-methylidene-4,13-dioxo-5,14-dioxatricyclo[10.2.1.02,6]pentadeca-7,12(15)-dien-11-yl] 2-methylpropanoate.
| Compound Name | [(1R,2S,6R,7E,11S)-8-(hydroxymethyl)-3-methylidene-4,13-dioxo-5,14-dioxatricyclo[10.2.1.02,6]pentadeca-7,12(15)-dien-11-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 163041654 |
| Molecular Formula | C19H22O7 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | [(1R,2S,6R,7E,11S)-8-(hydroxymethyl)-3-methylidene-4,13-dioxo-5,14-dioxatricyclo[10.2.1.02,6]pentadeca-7,12(15)-dien-11-yl] 2-methylpropanoate |
| SMILES | C=C1C(=O)O[C@@H]2/C=C(/CO)CC[C@H](OC(=O)C(C)C)C3=C[C@@H](OC3=O)[C@@H]12 |
| InChI | InChI=1S/C19H22O7/c1-9(2)17(21)24-13-5-4-11(8-20)6-14-16(10(3)18(22)25-14)15-7-12(13)19(23)26-15/h6-7,9,13-16,20H,3-5,8H2,1-2H3/b11-6+/t13-,14+,15+,16-/m0/s1 |
| InChIKey | MICXHPXXJBFMET-IZAULGOHSA-N |
| XLogP | 1.22 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|