C17H20O7 — CID 162911557
[(1R,2R,6S,8R,11R)-8-(hydroxymethyl)-3-methylidene-4,13-dioxo-5,14-dioxatricyclo[10.2.1.02,6]pentadec-12(15)-en-11-yl] acetate (PubChem CID 162911557) has the molecular formula C17H20O7 and a molecular weight of 336.34 g/mol. Its IUPAC name is [(1R,2R,6S,8R,11R)-8-(hydroxymethyl)-3-methylidene-4,13-dioxo-5,14-dioxatricyclo[10.2.1.02,6]pentadec-12(15)-en-11-yl] acetate.
| Compound Name | [(1R,2R,6S,8R,11R)-8-(hydroxymethyl)-3-methylidene-4,13-dioxo-5,14-dioxatricyclo[10.2.1.02,6]pentadec-12(15)-en-11-yl] acetate |
|---|---|
| PubChem CID | 162911557 |
| Molecular Formula | C17H20O7 |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | [(1R,2R,6S,8R,11R)-8-(hydroxymethyl)-3-methylidene-4,13-dioxo-5,14-dioxatricyclo[10.2.1.02,6]pentadec-12(15)-en-11-yl] acetate |
| SMILES | C=C1C(=O)O[C@H]2C[C@H](CO)CC[C@@H](OC(C)=O)C3=C[C@@H](OC3=O)[C@H]12 |
| InChI | InChI=1S/C17H20O7/c1-8-15-13(23-16(8)20)5-10(7-18)3-4-12(22-9(2)19)11-6-14(15)24-17(11)21/h6,10,12-15,18H,1,3-5,7H2,2H3/t10-,12-,13+,14-,15-/m1/s1 |
| InChIKey | GJZCYYPVEVTANZ-TVKJYDDYSA-N |
| XLogP | 0.66 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|