C17H20O6 — CID 162991785
(1R,2S,6R,7Z,11S)-11-ethoxy-8-(hydroxymethyl)-3-methylidene-5,14-dioxatricyclo[10.2.1.02,6]pentadeca-7,12(15)-diene-4,13-dione (PubChem CID 162991785) has the molecular formula C17H20O6 and a molecular weight of 320.34 g/mol. Its IUPAC name is (1R,2S,6R,7Z,11S)-11-ethoxy-8-(hydroxymethyl)-3-methylidene-5,14-dioxatricyclo[10.2.1.02,6]pentadeca-7,12(15)-diene-4,13-dione.
| Compound Name | (1R,2S,6R,7Z,11S)-11-ethoxy-8-(hydroxymethyl)-3-methylidene-5,14-dioxatricyclo[10.2.1.02,6]pentadeca-7,12(15)-diene-4,13-dione |
|---|---|
| PubChem CID | 162991785 |
| Molecular Formula | C17H20O6 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | (1R,2S,6R,7Z,11S)-11-ethoxy-8-(hydroxymethyl)-3-methylidene-5,14-dioxatricyclo[10.2.1.02,6]pentadeca-7,12(15)-diene-4,13-dione |
| SMILES | C=C1C(=O)O[C@@H]2/C=C(\CO)CC[C@H](OCC)C3=C[C@@H](OC3=O)[C@@H]12 |
| InChI | InChI=1S/C17H20O6/c1-3-21-12-5-4-10(8-18)6-13-15(9(2)16(19)22-13)14-7-11(12)17(20)23-14/h6-7,12-15,18H,2-5,8H2,1H3/b10-6-/t12-,13+,14+,15-/m0/s1 |
| InChIKey | PTJPAEBQCZMNAV-RBGROHTJSA-N |
| XLogP | 1.05 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|