C21H26O8 — CID 163031533
[12-(acetyloxymethyl)-8-formyl-4-methyl-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradeca-7,11-dien-10-yl] 2-methylpropanoate (PubChem CID 163031533) has the molecular formula C21H26O8 and a molecular weight of 406.43 g/mol. Its IUPAC name is [12-(acetyloxymethyl)-8-formyl-4-methyl-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradeca-7,11-dien-10-yl] 2-methylpropanoate.
| Compound Name | [12-(acetyloxymethyl)-8-formyl-4-methyl-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradeca-7,11-dien-10-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 163031533 |
| Molecular Formula | C21H26O8 |
| Molecular Weight | 406.43 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | [12-(acetyloxymethyl)-8-formyl-4-methyl-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradeca-7,11-dien-10-yl] 2-methylpropanoate |
| SMILES | CC(=O)OCC1=C2C(OC(=O)C(C)C)CC(C=O)=CCCC3(C)OC3C2OC1=O |
| InChI | InChI=1S/C21H26O8/c1-11(2)19(24)27-15-8-13(9-22)6-5-7-21(4)18(29-21)17-16(15)14(20(25)28-17)10-26-12(3)23/h6,9,11,15,17-18H,5,7-8,10H2,1-4H3 |
| InChIKey | KHZBZZREMZHCQN-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 108.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.43 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|