About [(2S)-6,6-dimethyl-5-oxo-2H-pyran-2-yl] 2-methylpropanoate
[(2S)-6,6-dimethyl-5-oxo-2H-pyran-2-yl] 2-methylpropanoate (PubChem CID 166439758) has the molecular formula C11H16O4
and a molecular weight of 212.25 g/mol. Its IUPAC name is [(2S)-6,6-dimethyl-5-oxo-2H-pyran-2-yl] 2-methylpropanoate.
Analyze [(2S)-6,6-dimethyl-5-oxo-2H-pyran-2-yl] 2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-6,6-dimethyl-5-oxo-2H-pyran-2-yl] 2-methylpropanoate?
The IUPAC name of [(2S)-6,6-dimethyl-5-oxo-2H-pyran-2-yl] 2-methylpropanoate (CID 166439758) is [(2S)-6,6-dimethyl-5-oxo-2H-pyran-2-yl] 2-methylpropanoate.
What is the SMILES notation for [(2S)-6,6-dimethyl-5-oxo-2H-pyran-2-yl] 2-methylpropanoate?
The canonical SMILES for [(2S)-6,6-dimethyl-5-oxo-2H-pyran-2-yl] 2-methylpropanoate is CC(C)C(=O)O[C@H]1C=CC(=O)C(C)(C)O1.
What is the InChIKey of [(2S)-6,6-dimethyl-5-oxo-2H-pyran-2-yl] 2-methylpropanoate?
The InChIKey is KMJVGDDQXGEKFJ-SECBINFHSA-N. The full InChI is InChI=1S/C11H16O4/c1-7(2)10(13)14-9-6-5-8(12)11(3,4)15-9/h5-7,9H,1-4H3/t9-/m1/s1.
What are the key properties of [(2S)-6,6-dimethyl-5-oxo-2H-pyran-2-yl] 2-methylpropanoate?
[(2S)-6,6-dimethyl-5-oxo-2H-pyran-2-yl] 2-methylpropanoate has a molecular weight of 212.25 g/mol, XLogP of 1.45, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-6,6-dimethyl-5-oxo-2H-pyran-2-yl] 2-methylpropanoate is sourced from PubChem (CID 166439758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).