C19H26O9 — CID 162862572
[(1S,2R,4R,8R,10S,11R,12S)-8-acetyloxy-12-(hydroxymethyl)-4,8-dimethyl-7,13-dioxo-3,14-dioxatricyclo[9.3.0.02,4]tetradecan-10-yl] acetate (PubChem CID 162862572) has the molecular formula C19H26O9 and a molecular weight of 398.41 g/mol. Its IUPAC name is [(1S,2R,4R,8R,10S,11R,12S)-8-acetyloxy-12-(hydroxymethyl)-4,8-dimethyl-7,13-dioxo-3,14-dioxatricyclo[9.3.0.02,4]tetradecan-10-yl] acetate.
| Compound Name | [(1S,2R,4R,8R,10S,11R,12S)-8-acetyloxy-12-(hydroxymethyl)-4,8-dimethyl-7,13-dioxo-3,14-dioxatricyclo[9.3.0.02,4]tetradecan-10-yl] acetate |
|---|---|
| PubChem CID | 162862572 |
| Molecular Formula | C19H26O9 |
| Molecular Weight | 398.41 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | [(1S,2R,4R,8R,10S,11R,12S)-8-acetyloxy-12-(hydroxymethyl)-4,8-dimethyl-7,13-dioxo-3,14-dioxatricyclo[9.3.0.02,4]tetradecan-10-yl] acetate |
| SMILES | CC(=O)O[C@H]1C[C@@](C)(OC(C)=O)C(=O)CC[C@@]2(C)O[C@@H]2[C@H]2OC(=O)[C@H](CO)[C@@H]21 |
| InChI | InChI=1S/C19H26O9/c1-9(21)25-12-7-19(4,27-10(2)22)13(23)5-6-18(3)16(28-18)15-14(12)11(8-20)17(24)26-15/h11-12,14-16,20H,5-8H2,1-4H3/t11-,12+,14-,15+,16-,18-,19-/m1/s1 |
| InChIKey | RBVQQTSGUPXDEI-OKFJPPBLSA-N |
| XLogP | 0.30 |
| TPSA | 128.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.41 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|