C20H26O8 — CID 162897233
[(1R,2S,3S,4R,7R,8S,10R,11R,13S,14R)-2-hydroxy-4-(hydroxymethyl)-10,14-dimethyl-5-oxo-6,9,15-trioxapentacyclo[9.4.0.01,14.03,7.08,10]pentadecan-13-yl] (E)-2-methylbut-2-enoate (PubChem CID 162897233) has the molecular formula C20H26O8 and a molecular weight of 394.42 g/mol. Its IUPAC name is [(1R,2S,3S,4R,7R,8S,10R,11R,13S,14R)-2-hydroxy-4-(hydroxymethyl)-10,14-dimethyl-5-oxo-6,9,15-trioxapentacyclo[9.4.0.01,14.03,7.08,10]pentadecan-13-yl] (E)-2-methylbut-2-enoate.
| Compound Name | [(1R,2S,3S,4R,7R,8S,10R,11R,13S,14R)-2-hydroxy-4-(hydroxymethyl)-10,14-dimethyl-5-oxo-6,9,15-trioxapentacyclo[9.4.0.01,14.03,7.08,10]pentadecan-13-yl] (E)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 162897233 |
| Molecular Formula | C20H26O8 |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | [(1R,2S,3S,4R,7R,8S,10R,11R,13S,14R)-2-hydroxy-4-(hydroxymethyl)-10,14-dimethyl-5-oxo-6,9,15-trioxapentacyclo[9.4.0.01,14.03,7.08,10]pentadecan-13-yl] (E)-2-methylbut-2-enoate |
| SMILES | C/C=C(\C)C(=O)O[C@H]1C[C@@H]2[C@@]3(C)O[C@H]3[C@@H]3OC(=O)[C@@H](CO)[C@H]3[C@H](O)[C@]23O[C@]13C |
| InChI | InChI=1S/C20H26O8/c1-5-8(2)16(23)25-11-6-10-18(3)15(27-18)13-12(9(7-21)17(24)26-13)14(22)20(10)19(11,4)28-20/h5,9-15,21-22H,6-7H2,1-4H3/b8-5+/t9-,10+,11-,12+,13+,14-,15-,18+,19+,20+/m0/s1 |
| InChIKey | CEWJOPKSFGXYQJ-QXHLJALSSA-N |
| XLogP | 0.09 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|