C22H28O7 — CID 162941413
(4-acetyloxy-8-hydroxy-1,5,8-trimethyl-2-oxo-1,3a,4,8a,9,9a-hexahydroazuleno[6,5-b]furan-9-yl) 2-methylbut-2-enoate (PubChem CID 162941413) has the molecular formula C22H28O7 and a molecular weight of 404.46 g/mol. Its IUPAC name is (4-acetyloxy-8-hydroxy-1,5,8-trimethyl-2-oxo-1,3a,4,8a,9,9a-hexahydroazuleno[6,5-b]furan-9-yl) 2-methylbut-2-enoate.
| Compound Name | (4-acetyloxy-8-hydroxy-1,5,8-trimethyl-2-oxo-1,3a,4,8a,9,9a-hexahydroazuleno[6,5-b]furan-9-yl) 2-methylbut-2-enoate |
|---|---|
| PubChem CID | 162941413 |
| Molecular Formula | C22H28O7 |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | (4-acetyloxy-8-hydroxy-1,5,8-trimethyl-2-oxo-1,3a,4,8a,9,9a-hexahydroazuleno[6,5-b]furan-9-yl) 2-methylbut-2-enoate |
| SMILES | CC=C(C)C(=O)OC1C2C(C)C(=O)OC2C(OC(C)=O)C(C)=C2C=CC(C)(O)C21 |
| InChI | InChI=1S/C22H28O7/c1-7-10(2)20(24)28-18-15-12(4)21(25)29-19(15)17(27-13(5)23)11(3)14-8-9-22(6,26)16(14)18/h7-9,12,15-19,26H,1-6H3 |
| InChIKey | GWKUMJYXLPVAEX-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|