C21H26O7 — CID 163104874
(5-acetyloxy-9-hydroxy-6,9-dimethyl-3-methylidene-2-oxo-4,5,9a,9b-tetrahydro-3aH-azuleno[4,5-b]furan-4-yl) 2-methylpropanoate (PubChem CID 163104874) has the molecular formula C21H26O7 and a molecular weight of 390.43 g/mol. Its IUPAC name is (5-acetyloxy-9-hydroxy-6,9-dimethyl-3-methylidene-2-oxo-4,5,9a,9b-tetrahydro-3aH-azuleno[4,5-b]furan-4-yl) 2-methylpropanoate.
| Compound Name | (5-acetyloxy-9-hydroxy-6,9-dimethyl-3-methylidene-2-oxo-4,5,9a,9b-tetrahydro-3aH-azuleno[4,5-b]furan-4-yl) 2-methylpropanoate |
|---|---|
| PubChem CID | 163104874 |
| Molecular Formula | C21H26O7 |
| Molecular Weight | 390.43 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | (5-acetyloxy-9-hydroxy-6,9-dimethyl-3-methylidene-2-oxo-4,5,9a,9b-tetrahydro-3aH-azuleno[4,5-b]furan-4-yl) 2-methylpropanoate |
| SMILES | C=C1C(=O)OC2C1C(OC(=O)C(C)C)C(OC(C)=O)C(C)=C1C=CC(C)(O)C12 |
| InChI | InChI=1S/C21H26O7/c1-9(2)19(23)28-18-14-11(4)20(24)27-17(14)15-13(7-8-21(15,6)25)10(3)16(18)26-12(5)22/h7-9,14-18,25H,4H2,1-3,5-6H3 |
| InChIKey | LIDRUBLEQLQTIW-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.43 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|