C21H28O8 — CID 163071380
[(3aR,4S,5S,6R,6aR,7S,9aS,9bS)-7-acetyloxy-4,6-dihydroxy-6,9-dimethyl-3-methylidene-2-oxo-4,5,6a,7,9a,9b-hexahydro-3aH-azuleno[4,5-b]furan-5-yl] 2-methylpropanoate (PubChem CID 163071380) has the molecular formula C21H28O8 and a molecular weight of 408.45 g/mol. Its IUPAC name is [(3aR,4S,5S,6R,6aR,7S,9aS,9bS)-7-acetyloxy-4,6-dihydroxy-6,9-dimethyl-3-methylidene-2-oxo-4,5,6a,7,9a,9b-hexahydro-3aH-azuleno[4,5-b]furan-5-yl] 2-methylpropanoate.
| Compound Name | [(3aR,4S,5S,6R,6aR,7S,9aS,9bS)-7-acetyloxy-4,6-dihydroxy-6,9-dimethyl-3-methylidene-2-oxo-4,5,6a,7,9a,9b-hexahydro-3aH-azuleno[4,5-b]furan-5-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 163071380 |
| Molecular Formula | C21H28O8 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | [(3aR,4S,5S,6R,6aR,7S,9aS,9bS)-7-acetyloxy-4,6-dihydroxy-6,9-dimethyl-3-methylidene-2-oxo-4,5,6a,7,9a,9b-hexahydro-3aH-azuleno[4,5-b]furan-5-yl] 2-methylpropanoate |
| SMILES | C=C1C(=O)O[C@@H]2[C@H]1[C@H](O)[C@H](OC(=O)C(C)C)[C@](C)(O)[C@@H]1[C@H]2C(C)=C[C@@H]1OC(C)=O |
| InChI | InChI=1S/C21H28O8/c1-8(2)19(24)29-18-16(23)14-10(4)20(25)28-17(14)13-9(3)7-12(27-11(5)22)15(13)21(18,6)26/h7-8,12-18,23,26H,4H2,1-3,5-6H3/t12-,13+,14+,15-,16-,17-,18-,21+/m0/s1 |
| InChIKey | SNDQMVKMRFXZNM-PDYMLDEMSA-N |
| XLogP | 0.90 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|