C24H30O9 — CID 11969994
[(6S,7R,9bR)-5,7-diacetyloxy-6-hydroxy-6,9-dimethyl-3-methylidene-2-oxo-4,5,6a,7,9a,9b-hexahydro-3aH-azuleno[4,5-b]furan-4-yl] (E)-2-methylbut-2-enoate (PubChem CID 11969994) has the molecular formula C24H30O9 and a molecular weight of 462.50 g/mol. Its IUPAC name is [(6S,7R,9bR)-5,7-diacetyloxy-6-hydroxy-6,9-dimethyl-3-methylidene-2-oxo-4,5,6a,7,9a,9b-hexahydro-3aH-azuleno[4,5-b]furan-4-yl] (E)-2-methylbut-2-enoate.
| Compound Name | [(6S,7R,9bR)-5,7-diacetyloxy-6-hydroxy-6,9-dimethyl-3-methylidene-2-oxo-4,5,6a,7,9a,9b-hexahydro-3aH-azuleno[4,5-b]furan-4-yl] (E)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 11969994 |
| Molecular Formula | C24H30O9 |
| Molecular Weight | 462.50 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | [(6S,7R,9bR)-5,7-diacetyloxy-6-hydroxy-6,9-dimethyl-3-methylidene-2-oxo-4,5,6a,7,9a,9b-hexahydro-3aH-azuleno[4,5-b]furan-4-yl] (E)-2-methylbut-2-enoate |
| SMILES | C=C1C(=O)O[C@H]2C1C(OC(=O)/C(C)=C/C)C(OC(C)=O)[C@@](C)(O)C1C2C(C)=C[C@H]1OC(C)=O |
| InChI | InChI=1S/C24H30O9/c1-8-10(2)22(27)33-20-17-12(4)23(28)32-19(17)16-11(3)9-15(30-13(5)25)18(16)24(7,29)21(20)31-14(6)26/h8-9,15-21,29H,4H2,1-3,5-7H3/b10-8+/t15-,16?,17?,18?,19-,20?,21?,24+/m1/s1 |
| InChIKey | YYXVRKOJSILGAG-LCLDOYGQSA-N |
| XLogP | 1.78 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.50 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|