C22H30O8 — CID 163002887
(7-acetyloxy-4,6-dihydroxy-6,9-dimethyl-3-methylidene-2-oxo-4,5,6a,7,9a,9b-hexahydro-3aH-azuleno[4,5-b]furan-5-yl) 3-methylbutanoate (PubChem CID 163002887) has the molecular formula C22H30O8 and a molecular weight of 422.47 g/mol. Its IUPAC name is (7-acetyloxy-4,6-dihydroxy-6,9-dimethyl-3-methylidene-2-oxo-4,5,6a,7,9a,9b-hexahydro-3aH-azuleno[4,5-b]furan-5-yl) 3-methylbutanoate.
| Compound Name | (7-acetyloxy-4,6-dihydroxy-6,9-dimethyl-3-methylidene-2-oxo-4,5,6a,7,9a,9b-hexahydro-3aH-azuleno[4,5-b]furan-5-yl) 3-methylbutanoate |
|---|---|
| PubChem CID | 163002887 |
| Molecular Formula | C22H30O8 |
| Molecular Weight | 422.47 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | (7-acetyloxy-4,6-dihydroxy-6,9-dimethyl-3-methylidene-2-oxo-4,5,6a,7,9a,9b-hexahydro-3aH-azuleno[4,5-b]furan-5-yl) 3-methylbutanoate |
| SMILES | C=C1C(=O)OC2C1C(O)C(OC(=O)CC(C)C)C(C)(O)C1C(OC(C)=O)C=C(C)C21 |
| InChI | InChI=1S/C22H30O8/c1-9(2)7-14(24)29-20-18(25)16-11(4)21(26)30-19(16)15-10(3)8-13(28-12(5)23)17(15)22(20,6)27/h8-9,13,15-20,25,27H,4,7H2,1-3,5-6H3 |
| InChIKey | NORZIJGYGVHETR-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.47 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|