C17H21ClO6 — CID 11199095
[(3aR,4S,6aS,8S,9S,9aR,9bS)-8-chloro-6a,9-dihydroxy-6,9-dimethyl-3-methylidene-2-oxo-3a,4,7,8,9a,9b-hexahydroazuleno[4,5-b]furan-4-yl] acetate (PubChem CID 11199095) has the molecular formula C17H21ClO6 and a molecular weight of 356.80 g/mol. Its IUPAC name is [(3aR,4S,6aS,8S,9S,9aR,9bS)-8-chloro-6a,9-dihydroxy-6,9-dimethyl-3-methylidene-2-oxo-3a,4,7,8,9a,9b-hexahydroazuleno[4,5-b]furan-4-yl] acetate.
| Compound Name | [(3aR,4S,6aS,8S,9S,9aR,9bS)-8-chloro-6a,9-dihydroxy-6,9-dimethyl-3-methylidene-2-oxo-3a,4,7,8,9a,9b-hexahydroazuleno[4,5-b]furan-4-yl] acetate |
|---|---|
| PubChem CID | 11199095 |
| Molecular Formula | C17H21ClO6 |
| Molecular Weight | 356.80 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | [(3aR,4S,6aS,8S,9S,9aR,9bS)-8-chloro-6a,9-dihydroxy-6,9-dimethyl-3-methylidene-2-oxo-3a,4,7,8,9a,9b-hexahydroazuleno[4,5-b]furan-4-yl] acetate |
| SMILES | C=C1C(=O)O[C@H]2[C@H]1[C@@H](OC(C)=O)C=C(C)[C@]1(O)C[C@H](Cl)[C@@](C)(O)[C@H]21 |
| InChI | InChI=1S/C17H21ClO6/c1-7-5-10(23-9(3)19)12-8(2)15(20)24-13(12)14-16(4,21)11(18)6-17(7,14)22/h5,10-14,21-22H,2,6H2,1,3-4H3/t10-,11-,12+,13-,14-,16+,17+/m0/s1 |
| InChIKey | JZWJJIYMBXLZAI-DBXVGDNOSA-N |
| XLogP | 1.09 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.80 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|