C19H24O9 — CID 100987445
[(3aS,4R,5R,6aR,9aS,9bS)-5-acetyloxy-9-hydroperoxy-6-hydroxy-6,9-dimethyl-3-methylidene-2-oxo-3a,4,5,6a,9a,9b-hexahydroazuleno[4,5-b]furan-4-yl] acetate (PubChem CID 100987445) has the molecular formula C19H24O9 and a molecular weight of 396.39 g/mol. Its IUPAC name is [(3aS,4R,5R,6aR,9aS,9bS)-5-acetyloxy-9-hydroperoxy-6-hydroxy-6,9-dimethyl-3-methylidene-2-oxo-3a,4,5,6a,9a,9b-hexahydroazuleno[4,5-b]furan-4-yl] acetate.
| Compound Name | [(3aS,4R,5R,6aR,9aS,9bS)-5-acetyloxy-9-hydroperoxy-6-hydroxy-6,9-dimethyl-3-methylidene-2-oxo-3a,4,5,6a,9a,9b-hexahydroazuleno[4,5-b]furan-4-yl] acetate |
|---|---|
| PubChem CID | 100987445 |
| Molecular Formula | C19H24O9 |
| Molecular Weight | 396.39 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | [(3aS,4R,5R,6aR,9aS,9bS)-5-acetyloxy-9-hydroperoxy-6-hydroxy-6,9-dimethyl-3-methylidene-2-oxo-3a,4,5,6a,9a,9b-hexahydroazuleno[4,5-b]furan-4-yl] acetate |
| SMILES | C=C1C(=O)O[C@H]2[C@H]1[C@@H](OC(C)=O)[C@@H](OC(C)=O)C(C)(O)[C@@H]1C=CC(C)(OO)[C@H]21 |
| InChI | InChI=1S/C19H24O9/c1-8-12-14(27-17(8)22)13-11(6-7-18(13,4)28-24)19(5,23)16(26-10(3)21)15(12)25-9(2)20/h6-7,11-16,23-24H,1H2,2-5H3/t11-,12+,13+,14+,15-,16-,18?,19?/m1/s1 |
| InChIKey | UAFKJNLTEMNRST-UNNZJBQLSA-N |
| XLogP | 0.76 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.39 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|