C17H20O8 — CID 163046569
[(3aR,4S,6aS,9R,9aS,9bS)-6a,9-dihydroperoxy-9-methyl-3,6-dimethylidene-2-oxo-4,5,9a,9b-tetrahydro-3aH-azuleno[4,5-b]furan-4-yl] acetate (PubChem CID 163046569) has the molecular formula C17H20O8 and a molecular weight of 352.34 g/mol. Its IUPAC name is [(3aR,4S,6aS,9R,9aS,9bS)-6a,9-dihydroperoxy-9-methyl-3,6-dimethylidene-2-oxo-4,5,9a,9b-tetrahydro-3aH-azuleno[4,5-b]furan-4-yl] acetate.
| Compound Name | [(3aR,4S,6aS,9R,9aS,9bS)-6a,9-dihydroperoxy-9-methyl-3,6-dimethylidene-2-oxo-4,5,9a,9b-tetrahydro-3aH-azuleno[4,5-b]furan-4-yl] acetate |
|---|---|
| PubChem CID | 163046569 |
| Molecular Formula | C17H20O8 |
| Molecular Weight | 352.34 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | [(3aR,4S,6aS,9R,9aS,9bS)-6a,9-dihydroperoxy-9-methyl-3,6-dimethylidene-2-oxo-4,5,9a,9b-tetrahydro-3aH-azuleno[4,5-b]furan-4-yl] acetate |
| SMILES | C=C1C(=O)O[C@H]2[C@H]1[C@@H](OC(C)=O)CC(=C)[C@]1(OO)C=C[C@@](C)(OO)[C@H]21 |
| InChI | InChI=1S/C17H20O8/c1-8-7-11(22-10(3)18)12-9(2)15(19)23-13(12)14-16(4,24-20)5-6-17(8,14)25-21/h5-6,11-14,20-21H,1-2,7H2,3-4H3/t11-,12+,13-,14-,16+,17+/m0/s1 |
| InChIKey | BYOHMNQOWFXGMQ-FGKYSUEKSA-N |
| XLogP | 1.64 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.34 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|