C17H24O8 — CID 14396711
(9,10,14-trihydroxy-5,9,14-trimethyl-4-oxo-3,12-dioxatetracyclo[8.4.0.02,6.011,13]tetradecan-7-yl) acetate (PubChem CID 14396711) has the molecular formula C17H24O8 and a molecular weight of 356.37 g/mol. Its IUPAC name is (9,10,14-trihydroxy-5,9,14-trimethyl-4-oxo-3,12-dioxatetracyclo[8.4.0.02,6.011,13]tetradecan-7-yl) acetate.
| Compound Name | (9,10,14-trihydroxy-5,9,14-trimethyl-4-oxo-3,12-dioxatetracyclo[8.4.0.02,6.011,13]tetradecan-7-yl) acetate |
|---|---|
| PubChem CID | 14396711 |
| Molecular Formula | C17H24O8 |
| Molecular Weight | 356.37 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | (9,10,14-trihydroxy-5,9,14-trimethyl-4-oxo-3,12-dioxatetracyclo[8.4.0.02,6.011,13]tetradecan-7-yl) acetate |
| SMILES | CC(=O)OC1CC(C)(O)C2(O)C3OC3C(C)(O)C2C2OC(=O)C(C)C12 |
| InChI | InChI=1S/C17H24O8/c1-6-9-8(23-7(2)18)5-15(3,20)17(22)11(10(9)24-14(6)19)16(4,21)12-13(17)25-12/h6,8-13,20-22H,5H2,1-4H3 |
| InChIKey | HVCVPIADBNQJRC-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 125.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.37 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|