C19H28O7 — CID 163025255
(6,6a,9-trihydroxy-3,6,9-trimethyl-2-oxo-3,3a,4,5,9a,9b-hexahydroazuleno[4,5-b]furan-4-yl) 2-methylpropanoate (PubChem CID 163025255) has the molecular formula C19H28O7 and a molecular weight of 368.43 g/mol. Its IUPAC name is (6,6a,9-trihydroxy-3,6,9-trimethyl-2-oxo-3,3a,4,5,9a,9b-hexahydroazuleno[4,5-b]furan-4-yl) 2-methylpropanoate.
| Compound Name | (6,6a,9-trihydroxy-3,6,9-trimethyl-2-oxo-3,3a,4,5,9a,9b-hexahydroazuleno[4,5-b]furan-4-yl) 2-methylpropanoate |
|---|---|
| PubChem CID | 163025255 |
| Molecular Formula | C19H28O7 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | (6,6a,9-trihydroxy-3,6,9-trimethyl-2-oxo-3,3a,4,5,9a,9b-hexahydroazuleno[4,5-b]furan-4-yl) 2-methylpropanoate |
| SMILES | CC(C)C(=O)OC1CC(C)(O)C2(O)C=CC(C)(O)C2C2OC(=O)C(C)C12 |
| InChI | InChI=1S/C19H28O7/c1-9(2)15(20)25-11-8-18(5,23)19(24)7-6-17(4,22)14(19)13-12(11)10(3)16(21)26-13/h6-7,9-14,22-24H,8H2,1-5H3 |
| InChIKey | XZSXZVXLFVLPCM-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|