C15H22O5 — CID 163041368
6,6a,9-trihydroxy-3,6,9-trimethyl-3,3a,4,5,9a,9b-hexahydroazuleno[4,5-b]furan-2-one (PubChem CID 163041368) has the molecular formula C15H22O5 and a molecular weight of 282.34 g/mol. Its IUPAC name is 6,6a,9-trihydroxy-3,6,9-trimethyl-3,3a,4,5,9a,9b-hexahydroazuleno[4,5-b]furan-2-one.
| Compound Name | 6,6a,9-trihydroxy-3,6,9-trimethyl-3,3a,4,5,9a,9b-hexahydroazuleno[4,5-b]furan-2-one |
|---|---|
| PubChem CID | 163041368 |
| Molecular Formula | C15H22O5 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 6,6a,9-trihydroxy-3,6,9-trimethyl-3,3a,4,5,9a,9b-hexahydroazuleno[4,5-b]furan-2-one |
| SMILES | CC1C(=O)OC2C1CCC(C)(O)C1(O)C=CC(C)(O)C21 |
| InChI | InChI=1S/C15H22O5/c1-8-9-4-5-14(3,18)15(19)7-6-13(2,17)11(15)10(9)20-12(8)16/h6-11,17-19H,4-5H2,1-3H3 |
| InChIKey | BMANGNRYIVLQNA-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|