C15H20O5 — CID 163064454
(1S,2R,5S,6S,9S,10S,11R)-2-hydroxy-2,6,11-trimethyl-8,12,13-trioxatetracyclo[9.2.2.01,10.05,9]pentadec-14-en-7-one (PubChem CID 163064454) has the molecular formula C15H20O5 and a molecular weight of 280.32 g/mol. Its IUPAC name is (1S,2R,5S,6S,9S,10S,11R)-2-hydroxy-2,6,11-trimethyl-8,12,13-trioxatetracyclo[9.2.2.01,10.05,9]pentadec-14-en-7-one.
| Compound Name | (1S,2R,5S,6S,9S,10S,11R)-2-hydroxy-2,6,11-trimethyl-8,12,13-trioxatetracyclo[9.2.2.01,10.05,9]pentadec-14-en-7-one |
|---|---|
| PubChem CID | 163064454 |
| Molecular Formula | C15H20O5 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | (1S,2R,5S,6S,9S,10S,11R)-2-hydroxy-2,6,11-trimethyl-8,12,13-trioxatetracyclo[9.2.2.01,10.05,9]pentadec-14-en-7-one |
| SMILES | C[C@@H]1C(=O)O[C@H]2[C@H]1CC[C@@](C)(O)[C@@]13C=C[C@@](C)(OO1)[C@H]23 |
| InChI | InChI=1S/C15H20O5/c1-8-9-4-5-14(3,17)15-7-6-13(2,19-20-15)11(15)10(9)18-12(8)16/h6-11,17H,4-5H2,1-3H3/t8-,9-,10-,11-,13+,14+,15-/m0/s1 |
| InChIKey | HUXBJEGFQKYIMS-WSKMSCCKSA-N |
| XLogP | 1.35 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|