C15H22O3 — CID 162870577
(1R,2S,3S,6R,7S,10R,11S)-1,6,10-trimethyl-4,14-dioxatetracyclo[9.2.1.02,10.03,7]tetradecan-5-one (PubChem CID 162870577) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is (1R,2S,3S,6R,7S,10R,11S)-1,6,10-trimethyl-4,14-dioxatetracyclo[9.2.1.02,10.03,7]tetradecan-5-one.
| Compound Name | (1R,2S,3S,6R,7S,10R,11S)-1,6,10-trimethyl-4,14-dioxatetracyclo[9.2.1.02,10.03,7]tetradecan-5-one |
|---|---|
| PubChem CID | 162870577 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | (1R,2S,3S,6R,7S,10R,11S)-1,6,10-trimethyl-4,14-dioxatetracyclo[9.2.1.02,10.03,7]tetradecan-5-one |
| SMILES | C[C@H]1C(=O)O[C@H]2[C@H]1CC[C@@]1(C)[C@@H]3CC[C@@](C)(O3)[C@H]21 |
| InChI | InChI=1S/C15H22O3/c1-8-9-4-6-14(2)10-5-7-15(3,18-10)12(14)11(9)17-13(8)16/h8-12H,4-7H2,1-3H3/t8-,9+,10+,11+,12-,14+,15-/m1/s1 |
| InChIKey | RNZCIODIVSAJQF-FPOFAZKOSA-N |
| XLogP | 2.53 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |