C15H20O5 — CID 162934242
(3S,3aR,5aR,9S,9aS,9bS)-9-hydroperoxy-3,5a,9-trimethyl-3,3a,4,5,9a,9b-hexahydrobenzo[g][1]benzofuran-2,6-dione (PubChem CID 162934242) has the molecular formula C15H20O5 and a molecular weight of 280.32 g/mol. Its IUPAC name is (3S,3aR,5aR,9S,9aS,9bS)-9-hydroperoxy-3,5a,9-trimethyl-3,3a,4,5,9a,9b-hexahydrobenzo[g][1]benzofuran-2,6-dione.
| Compound Name | (3S,3aR,5aR,9S,9aS,9bS)-9-hydroperoxy-3,5a,9-trimethyl-3,3a,4,5,9a,9b-hexahydrobenzo[g][1]benzofuran-2,6-dione |
|---|---|
| PubChem CID | 162934242 |
| Molecular Formula | C15H20O5 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | (3S,3aR,5aR,9S,9aS,9bS)-9-hydroperoxy-3,5a,9-trimethyl-3,3a,4,5,9a,9b-hexahydrobenzo[g][1]benzofuran-2,6-dione |
| SMILES | C[C@@H]1C(=O)O[C@H]2[C@@H]1CC[C@@]1(C)C(=O)C=C[C@](C)(OO)[C@H]21 |
| InChI | InChI=1S/C15H20O5/c1-8-9-4-6-14(2)10(16)5-7-15(3,20-18)12(14)11(9)19-13(8)17/h5,7-9,11-12,18H,4,6H2,1-3H3/t8-,9+,11-,12+,14-,15-/m0/s1 |
| InChIKey | GPWOVUKAMABICF-FVQLFGEKSA-N |
| XLogP | 1.97 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|