C23H34O10 — CID 163047498
[6-(4-ethyl-4-methyl-2-oxooxolan-3-yl)oxy-5-hydroxy-2-(hydroxymethyl)-4-(2-methylbut-2-enoyloxy)oxan-3-yl] 2-methylbut-2-enoate (PubChem CID 163047498) has the molecular formula C23H34O10 and a molecular weight of 470.52 g/mol. Its IUPAC name is [6-(4-ethyl-4-methyl-2-oxooxolan-3-yl)oxy-5-hydroxy-2-(hydroxymethyl)-4-(2-methylbut-2-enoyloxy)oxan-3-yl] 2-methylbut-2-enoate.
| Compound Name | [6-(4-ethyl-4-methyl-2-oxooxolan-3-yl)oxy-5-hydroxy-2-(hydroxymethyl)-4-(2-methylbut-2-enoyloxy)oxan-3-yl] 2-methylbut-2-enoate |
|---|---|
| PubChem CID | 163047498 |
| Molecular Formula | C23H34O10 |
| Molecular Weight | 470.52 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | [6-(4-ethyl-4-methyl-2-oxooxolan-3-yl)oxy-5-hydroxy-2-(hydroxymethyl)-4-(2-methylbut-2-enoyloxy)oxan-3-yl] 2-methylbut-2-enoate |
| SMILES | CC=C(C)C(=O)OC1C(CO)OC(OC2C(=O)OCC2(C)CC)C(O)C1OC(=O)C(C)=CC |
| InChI | InChI=1S/C23H34O10/c1-7-12(4)19(26)31-16-14(10-24)30-22(15(25)17(16)32-20(27)13(5)8-2)33-18-21(28)29-11-23(18,6)9-3/h7-8,14-18,22,24-25H,9-11H2,1-6H3 |
| InChIKey | HYVRDAVINPRPHX-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 137.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.52 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|