C26H42O10 — CID 162846638
[(2R,3R,4R,5R,6S)-6-[(3S)-7-hydroperoxy-3,7-dimethyloct-1-en-3-yl]oxy-5-hydroxy-2-(hydroxymethyl)-4-[(Z)-2-methylbut-2-enoyl]oxyoxan-3-yl] (Z)-2-methylbut-2-enoate (PubChem CID 162846638) has the molecular formula C26H42O10 and a molecular weight of 514.61 g/mol. Its IUPAC name is [(2R,3R,4R,5R,6S)-6-[(3S)-7-hydroperoxy-3,7-dimethyloct-1-en-3-yl]oxy-5-hydroxy-2-(hydroxymethyl)-4-[(Z)-2-methylbut-2-enoyl]oxyoxan-3-yl] (Z)-2-methylbut-2-enoate.
| Compound Name | [(2R,3R,4R,5R,6S)-6-[(3S)-7-hydroperoxy-3,7-dimethyloct-1-en-3-yl]oxy-5-hydroxy-2-(hydroxymethyl)-4-[(Z)-2-methylbut-2-enoyl]oxyoxan-3-yl] (Z)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 162846638 |
| Molecular Formula | C26H42O10 |
| Molecular Weight | 514.61 g/mol |
| Exact Mass | 514.28 |
| IUPAC Name | [(2R,3R,4R,5R,6S)-6-[(3S)-7-hydroperoxy-3,7-dimethyloct-1-en-3-yl]oxy-5-hydroxy-2-(hydroxymethyl)-4-[(Z)-2-methylbut-2-enoyl]oxyoxan-3-yl] (Z)-2-methylbut-2-enoate |
| SMILES | C=C[C@](C)(CCCC(C)(C)OO)O[C@@H]1O[C@H](CO)[C@@H](OC(=O)/C(C)=C\C)[C@H](OC(=O)/C(C)=C\C)[C@H]1O |
| InChI | InChI=1S/C26H42O10/c1-9-16(4)22(29)33-20-18(15-27)32-24(19(28)21(20)34-23(30)17(5)10-2)35-26(8,11-3)14-12-13-25(6,7)36-31/h9-11,18-21,24,27-28,31H,3,12-15H2,1-2,4-8H3/b16-9-,17-10-/t18-,19-,20-,21-,24+,26-/m1/s1 |
| InChIKey | QEWXBJHBASWWKI-WWCLKHKGSA-N |
| XLogP | 3.22 |
| TPSA | 140.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.61 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|