C22H28O8 — CID 10093584
[3,6,7-tris(acetyloxymethyl)-1,4,5,8-tetrahydronaphthalen-2-yl]methyl acetate (PubChem CID 10093584) has the molecular formula C22H28O8 and a molecular weight of 420.46 g/mol. Its IUPAC name is [3,6,7-tris(acetyloxymethyl)-1,4,5,8-tetrahydronaphthalen-2-yl]methyl acetate.
| Compound Name | [3,6,7-tris(acetyloxymethyl)-1,4,5,8-tetrahydronaphthalen-2-yl]methyl acetate |
|---|---|
| PubChem CID | 10093584 |
| Molecular Formula | C22H28O8 |
| Molecular Weight | 420.46 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | [3,6,7-tris(acetyloxymethyl)-1,4,5,8-tetrahydronaphthalen-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1=C(COC(C)=O)CC2=C(C1)CC(COC(C)=O)=C(COC(C)=O)C2 |
| InChI | InChI=1S/C22H28O8/c1-13(23)27-9-19-5-17-7-21(11-29-15(3)25)22(12-30-16(4)26)8-18(17)6-20(19)10-28-14(2)24/h5-12H2,1-4H3 |
| InChIKey | UPTROHKWLAXATF-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.46 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|