C20H24O8 — CID 73449970
[3,5,7-tris(acetyloxymethyl)cycloocta-1,3,5,7-tetraen-1-yl]methyl acetate (PubChem CID 73449970) has the molecular formula C20H24O8 and a molecular weight of 392.40 g/mol. Its IUPAC name is [3,5,7-tris(acetyloxymethyl)cycloocta-1,3,5,7-tetraen-1-yl]methyl acetate.
| Compound Name | [3,5,7-tris(acetyloxymethyl)cycloocta-1,3,5,7-tetraen-1-yl]methyl acetate |
|---|---|
| PubChem CID | 73449970 |
| Molecular Formula | C20H24O8 |
| Molecular Weight | 392.40 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | [3,5,7-tris(acetyloxymethyl)cycloocta-1,3,5,7-tetraen-1-yl]methyl acetate |
| SMILES | CC(=O)OCC1=CC(COC(C)=O)=CC(COC(C)=O)=CC(COC(C)=O)=C1 |
| InChI | InChI=1S/C20H24O8/c1-13(21)25-9-17-5-18(10-26-14(2)22)7-20(12-28-16(4)24)8-19(6-17)11-27-15(3)23/h5-8H,9-12H2,1-4H3 |
| InChIKey | ALIGRMSWDPMEOE-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.40 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|